About [2-(2,4-difluorophenyl)-2-oxoethyl] 5-amino-3-ethyl-1-propylpyrazole-4-carboxylate
[2-(2,4-difluorophenyl)-2-oxoethyl] 5-amino-3-ethyl-1-propylpyrazole-4-carboxylate (PubChem CID 135370777) has the molecular formula C17H19F2N3O3
and a molecular weight of 351.35 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)-2-oxoethyl] 5-amino-3-ethyl-1-propylpyrazole-4-carboxylate.
Molecular Properties
| Compound Name | [2-(2,4-difluorophenyl)-2-oxoethyl] 5-amino-3-ethyl-1-propylpyrazole-4-carboxylate |
| PubChem CID | 135370777 |
| Molecular Formula | C17H19F2N3O3 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | [2-(2,4-difluorophenyl)-2-oxoethyl] 5-amino-3-ethyl-1-propylpyrazole-4-carboxylate |
| SMILES | CCCn1nc(CC)c(C(=O)OCC(=O)c2ccc(F)cc2F)c1N |
| InChI | InChI=1S/C17H19F2N3O3/c1-3-7-22-16(20)15(13(4-2)21-22)17(24)25-9-14(23)11-6-5-10(18)8-12(11)19/h5-6,8H,3-4,7,9,20H2,1-2H3 |
| InChIKey | JGFLAZMUIKHVCX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(2,4-difluorophenyl)-2-oxoethyl] 5-amino-3-ethyl-1-propylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,4-difluorophenyl)-2-oxoethyl] 5-amino-3-ethyl-1-propylpyrazole-4-carboxylate?
The IUPAC name of [2-(2,4-difluorophenyl)-2-oxoethyl] 5-amino-3-ethyl-1-propylpyrazole-4-carboxylate (CID 135370777) is [2-(2,4-difluorophenyl)-2-oxoethyl] 5-amino-3-ethyl-1-propylpyrazole-4-carboxylate.
What is the SMILES notation for [2-(2,4-difluorophenyl)-2-oxoethyl] 5-amino-3-ethyl-1-propylpyrazole-4-carboxylate?
The canonical SMILES for [2-(2,4-difluorophenyl)-2-oxoethyl] 5-amino-3-ethyl-1-propylpyrazole-4-carboxylate is CCCn1nc(CC)c(C(=O)OCC(=O)c2ccc(F)cc2F)c1N.
What is the InChIKey of [2-(2,4-difluorophenyl)-2-oxoethyl] 5-amino-3-ethyl-1-propylpyrazole-4-carboxylate?
The InChIKey is JGFLAZMUIKHVCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F2N3O3/c1-3-7-22-16(20)15(13(4-2)21-22)17(24)25-9-14(23)11-6-5-10(18)8-12(11)19/h5-6,8H,3-4,7,9,20H2,1-2H3.
What are the key properties of [2-(2,4-difluorophenyl)-2-oxoethyl] 5-amino-3-ethyl-1-propylpyrazole-4-carboxylate?
[2-(2,4-difluorophenyl)-2-oxoethyl] 5-amino-3-ethyl-1-propylpyrazole-4-carboxylate has a molecular weight of 351.35 g/mol, XLogP of 2.76, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-difluorophenyl)-2-oxoethyl] 5-amino-3-ethyl-1-propylpyrazole-4-carboxylate is sourced from PubChem (CID 135370777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).