About ethyl 5-amino-1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]-3-ethylpyrazole-4-carboxylate
ethyl 5-amino-1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]-3-ethylpyrazole-4-carboxylate (PubChem CID 135371071) has the molecular formula C17H30N4O3
and a molecular weight of 338.45 g/mol. Its IUPAC name is ethyl 5-amino-1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]-3-ethylpyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-amino-1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]-3-ethylpyrazole-4-carboxylate |
| PubChem CID | 135371071 |
| Molecular Formula | C17H30N4O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | ethyl 5-amino-1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]-3-ethylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(CC)nn(CCCN2C[C@@H](C)O[C@@H](C)C2)c1N |
| InChI | InChI=1S/C17H30N4O3/c1-5-14-15(17(22)23-6-2)16(18)21(19-14)9-7-8-20-10-12(3)24-13(4)11-20/h12-13H,5-11,18H2,1-4H3/t12-,13+ |
| InChIKey | CAANDRCGRCYCMQ-BETUJISGSA-N |
| XLogP | 1.70 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 5-amino-1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]-3-ethylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-amino-1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]-3-ethylpyrazole-4-carboxylate?
The IUPAC name of ethyl 5-amino-1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]-3-ethylpyrazole-4-carboxylate (CID 135371071) is ethyl 5-amino-1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]-3-ethylpyrazole-4-carboxylate.
What is the SMILES notation for ethyl 5-amino-1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]-3-ethylpyrazole-4-carboxylate?
The canonical SMILES for ethyl 5-amino-1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]-3-ethylpyrazole-4-carboxylate is CCOC(=O)c1c(CC)nn(CCCN2C[C@@H](C)O[C@@H](C)C2)c1N.
What is the InChIKey of ethyl 5-amino-1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]-3-ethylpyrazole-4-carboxylate?
The InChIKey is CAANDRCGRCYCMQ-BETUJISGSA-N. The full InChI is InChI=1S/C17H30N4O3/c1-5-14-15(17(22)23-6-2)16(18)21(19-14)9-7-8-20-10-12(3)24-13(4)11-20/h12-13H,5-11,18H2,1-4H3/t12-,13+.
What are the key properties of ethyl 5-amino-1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]-3-ethylpyrazole-4-carboxylate?
ethyl 5-amino-1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]-3-ethylpyrazole-4-carboxylate has a molecular weight of 338.45 g/mol, XLogP of 1.70, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-amino-1-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]-3-ethylpyrazole-4-carboxylate is sourced from PubChem (CID 135371071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).