About 2,5-dimethyl-4-phenoxy-N'-propylbenzenecarboximidamide
2,5-dimethyl-4-phenoxy-N'-propylbenzenecarboximidamide (PubChem CID 135371153) has the molecular formula C18H22N2O
and a molecular weight of 282.39 g/mol. Its IUPAC name is 2,5-dimethyl-4-phenoxy-N'-propylbenzenecarboximidamide.
Molecular Properties
| Compound Name | 2,5-dimethyl-4-phenoxy-N'-propylbenzenecarboximidamide |
| PubChem CID | 135371153 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2,5-dimethyl-4-phenoxy-N'-propylbenzenecarboximidamide |
| SMILES | CCC/N=C(\N)c1cc(C)c(Oc2ccccc2)cc1C |
| InChI | InChI=1S/C18H22N2O/c1-4-10-20-18(19)16-11-14(3)17(12-13(16)2)21-15-8-6-5-7-9-15/h5-9,11-12H,4,10H2,1-3H3,(H2,19,20) |
| InChIKey | CEYOYTILGMZAHK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-4-phenoxy-N'-propylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-4-phenoxy-N'-propylbenzenecarboximidamide?
The IUPAC name of 2,5-dimethyl-4-phenoxy-N'-propylbenzenecarboximidamide (CID 135371153) is 2,5-dimethyl-4-phenoxy-N'-propylbenzenecarboximidamide.
What is the SMILES notation for 2,5-dimethyl-4-phenoxy-N'-propylbenzenecarboximidamide?
The canonical SMILES for 2,5-dimethyl-4-phenoxy-N'-propylbenzenecarboximidamide is CCC/N=C(\N)c1cc(C)c(Oc2ccccc2)cc1C.
What is the InChIKey of 2,5-dimethyl-4-phenoxy-N'-propylbenzenecarboximidamide?
The InChIKey is CEYOYTILGMZAHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O/c1-4-10-20-18(19)16-11-14(3)17(12-13(16)2)21-15-8-6-5-7-9-15/h5-9,11-12H,4,10H2,1-3H3,(H2,19,20).
What are the key properties of 2,5-dimethyl-4-phenoxy-N'-propylbenzenecarboximidamide?
2,5-dimethyl-4-phenoxy-N'-propylbenzenecarboximidamide has a molecular weight of 282.39 g/mol, XLogP of 4.21, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-4-phenoxy-N'-propylbenzenecarboximidamide is sourced from PubChem (CID 135371153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).