About ethoxymethyl 4-amino-3-(cyclopropylcarbamoyl)-1,2-thiazole-5-carboxylate
ethoxymethyl 4-amino-3-(cyclopropylcarbamoyl)-1,2-thiazole-5-carboxylate (PubChem CID 135371663) has the molecular formula C11H15N3O4S
and a molecular weight of 285.32 g/mol. Its IUPAC name is ethoxymethyl 4-amino-3-(cyclopropylcarbamoyl)-1,2-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | ethoxymethyl 4-amino-3-(cyclopropylcarbamoyl)-1,2-thiazole-5-carboxylate |
| PubChem CID | 135371663 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | ethoxymethyl 4-amino-3-(cyclopropylcarbamoyl)-1,2-thiazole-5-carboxylate |
| SMILES | CCOCOC(=O)c1snc(C(=O)NC2CC2)c1N |
| InChI | InChI=1S/C11H15N3O4S/c1-2-17-5-18-11(16)9-7(12)8(14-19-9)10(15)13-6-3-4-6/h6H,2-5,12H2,1H3,(H,13,15) |
| InChIKey | OHWUPHPMSPGTJL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethoxymethyl 4-amino-3-(cyclopropylcarbamoyl)-1,2-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxymethyl 4-amino-3-(cyclopropylcarbamoyl)-1,2-thiazole-5-carboxylate?
The IUPAC name of ethoxymethyl 4-amino-3-(cyclopropylcarbamoyl)-1,2-thiazole-5-carboxylate (CID 135371663) is ethoxymethyl 4-amino-3-(cyclopropylcarbamoyl)-1,2-thiazole-5-carboxylate.
What is the SMILES notation for ethoxymethyl 4-amino-3-(cyclopropylcarbamoyl)-1,2-thiazole-5-carboxylate?
The canonical SMILES for ethoxymethyl 4-amino-3-(cyclopropylcarbamoyl)-1,2-thiazole-5-carboxylate is CCOCOC(=O)c1snc(C(=O)NC2CC2)c1N.
What is the InChIKey of ethoxymethyl 4-amino-3-(cyclopropylcarbamoyl)-1,2-thiazole-5-carboxylate?
The InChIKey is OHWUPHPMSPGTJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O4S/c1-2-17-5-18-11(16)9-7(12)8(14-19-9)10(15)13-6-3-4-6/h6H,2-5,12H2,1H3,(H,13,15).
What are the key properties of ethoxymethyl 4-amino-3-(cyclopropylcarbamoyl)-1,2-thiazole-5-carboxylate?
ethoxymethyl 4-amino-3-(cyclopropylcarbamoyl)-1,2-thiazole-5-carboxylate has a molecular weight of 285.32 g/mol, XLogP of 0.77, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxymethyl 4-amino-3-(cyclopropylcarbamoyl)-1,2-thiazole-5-carboxylate is sourced from PubChem (CID 135371663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).