About N-[7-bromo-4-chloro-1-(2,2-difluoroethyl)indazol-3-yl]methanesulfonamide
N-[7-bromo-4-chloro-1-(2,2-difluoroethyl)indazol-3-yl]methanesulfonamide (PubChem CID 135371780) has the molecular formula C10H9BrClF2N3O2S
and a molecular weight of 388.62 g/mol. Its IUPAC name is N-[7-bromo-4-chloro-1-(2,2-difluoroethyl)indazol-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[7-bromo-4-chloro-1-(2,2-difluoroethyl)indazol-3-yl]methanesulfonamide |
| PubChem CID | 135371780 |
| Molecular Formula | C10H9BrClF2N3O2S |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 386.93 |
| IUPAC Name | N-[7-bromo-4-chloro-1-(2,2-difluoroethyl)indazol-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1nn(CC(F)F)c2c(Br)ccc(Cl)c12 |
| InChI | InChI=1S/C10H9BrClF2N3O2S/c1-20(18,19)16-10-8-6(12)3-2-5(11)9(8)17(15-10)4-7(13)14/h2-3,7H,4H2,1H3,(H,15,16) |
| InChIKey | SFQGKMUQZGPZHN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[7-bromo-4-chloro-1-(2,2-difluoroethyl)indazol-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[7-bromo-4-chloro-1-(2,2-difluoroethyl)indazol-3-yl]methanesulfonamide?
The IUPAC name of N-[7-bromo-4-chloro-1-(2,2-difluoroethyl)indazol-3-yl]methanesulfonamide (CID 135371780) is N-[7-bromo-4-chloro-1-(2,2-difluoroethyl)indazol-3-yl]methanesulfonamide.
What is the SMILES notation for N-[7-bromo-4-chloro-1-(2,2-difluoroethyl)indazol-3-yl]methanesulfonamide?
The canonical SMILES for N-[7-bromo-4-chloro-1-(2,2-difluoroethyl)indazol-3-yl]methanesulfonamide is CS(=O)(=O)Nc1nn(CC(F)F)c2c(Br)ccc(Cl)c12.
What is the InChIKey of N-[7-bromo-4-chloro-1-(2,2-difluoroethyl)indazol-3-yl]methanesulfonamide?
The InChIKey is SFQGKMUQZGPZHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrClF2N3O2S/c1-20(18,19)16-10-8-6(12)3-2-5(11)9(8)17(15-10)4-7(13)14/h2-3,7H,4H2,1H3,(H,15,16).
What are the key properties of N-[7-bromo-4-chloro-1-(2,2-difluoroethyl)indazol-3-yl]methanesulfonamide?
N-[7-bromo-4-chloro-1-(2,2-difluoroethyl)indazol-3-yl]methanesulfonamide has a molecular weight of 388.62 g/mol, XLogP of 3.09, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[7-bromo-4-chloro-1-(2,2-difluoroethyl)indazol-3-yl]methanesulfonamide is sourced from PubChem (CID 135371780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).