About 1-(6-bromo-1-methylpyrrolo[3,2-b]pyridin-5-yl)-2-(3,5-difluorophenyl)ethanol
1-(6-bromo-1-methylpyrrolo[3,2-b]pyridin-5-yl)-2-(3,5-difluorophenyl)ethanol (PubChem CID 135371864) has the molecular formula C16H13BrF2N2O
and a molecular weight of 367.19 g/mol. Its IUPAC name is 1-(6-bromo-1-methylpyrrolo[3,2-b]pyridin-5-yl)-2-(3,5-difluorophenyl)ethanol.
Molecular Properties
| Compound Name | 1-(6-bromo-1-methylpyrrolo[3,2-b]pyridin-5-yl)-2-(3,5-difluorophenyl)ethanol |
| PubChem CID | 135371864 |
| Molecular Formula | C16H13BrF2N2O |
| Molecular Weight | 367.19 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 1-(6-bromo-1-methylpyrrolo[3,2-b]pyridin-5-yl)-2-(3,5-difluorophenyl)ethanol |
| SMILES | Cn1ccc2nc(C(O)Cc3cc(F)cc(F)c3)c(Br)cc21 |
| InChI | InChI=1S/C16H13BrF2N2O/c1-21-3-2-13-14(21)8-12(17)16(20-13)15(22)6-9-4-10(18)7-11(19)5-9/h2-5,7-8,15,22H,6H2,1H3 |
| InChIKey | HPVGMIJLFJIOAW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.19 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(6-bromo-1-methylpyrrolo[3,2-b]pyridin-5-yl)-2-(3,5-difluorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-bromo-1-methylpyrrolo[3,2-b]pyridin-5-yl)-2-(3,5-difluorophenyl)ethanol?
The IUPAC name of 1-(6-bromo-1-methylpyrrolo[3,2-b]pyridin-5-yl)-2-(3,5-difluorophenyl)ethanol (CID 135371864) is 1-(6-bromo-1-methylpyrrolo[3,2-b]pyridin-5-yl)-2-(3,5-difluorophenyl)ethanol.
What is the SMILES notation for 1-(6-bromo-1-methylpyrrolo[3,2-b]pyridin-5-yl)-2-(3,5-difluorophenyl)ethanol?
The canonical SMILES for 1-(6-bromo-1-methylpyrrolo[3,2-b]pyridin-5-yl)-2-(3,5-difluorophenyl)ethanol is Cn1ccc2nc(C(O)Cc3cc(F)cc(F)c3)c(Br)cc21.
What is the InChIKey of 1-(6-bromo-1-methylpyrrolo[3,2-b]pyridin-5-yl)-2-(3,5-difluorophenyl)ethanol?
The InChIKey is HPVGMIJLFJIOAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13BrF2N2O/c1-21-3-2-13-14(21)8-12(17)16(20-13)15(22)6-9-4-10(18)7-11(19)5-9/h2-5,7-8,15,22H,6H2,1H3.
What are the key properties of 1-(6-bromo-1-methylpyrrolo[3,2-b]pyridin-5-yl)-2-(3,5-difluorophenyl)ethanol?
1-(6-bromo-1-methylpyrrolo[3,2-b]pyridin-5-yl)-2-(3,5-difluorophenyl)ethanol has a molecular weight of 367.19 g/mol, XLogP of 3.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-bromo-1-methylpyrrolo[3,2-b]pyridin-5-yl)-2-(3,5-difluorophenyl)ethanol is sourced from PubChem (CID 135371864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).