C31H42N6O2 — CID 135371955
(E)-N-[2-(1-methylpiperidin-4-yl)ethyl]-3-[5-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]furan-2-yl]prop-2-enamide (PubChem CID 135371955) has the molecular formula C31H42N6O2 and a molecular weight of 530.72 g/mol. Its IUPAC name is (E)-N-[2-(1-methylpiperidin-4-yl)ethyl]-3-[5-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[2-(1-methylpiperidin-4-yl)ethyl]-3-[5-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 135371955 |
| Molecular Formula | C31H42N6O2 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | (E)-N-[2-(1-methylpiperidin-4-yl)ethyl]-3-[5-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]furan-2-yl]prop-2-enamide |
| SMILES | CN1CCC(CCNC(=O)/C=C/c2ccc(-c3cc(NCCCN4CCCCC4)c4cnccc4n3)o2)CC1 |
| InChI | InChI=1S/C31H42N6O2/c1-36-20-12-24(13-21-36)10-16-34-31(38)9-7-25-6-8-30(39-25)29-22-28(26-23-32-15-11-27(26)35-29)33-14-5-19-37-17-3-2-4-18-37/h6-9,11,15,22-24H,2-5,10,12-14,16-21H2,1H3,(H,33,35)(H,34,38)/b9-7+ |
| InChIKey | TXLQQTAHFGRWGV-VQHVLOKHSA-N |
| XLogP | 5.04 |
| TPSA | 86.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|