About hydron;octanoate
hydron;octanoate (PubChem CID 135372298) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is hydron;octanoate.
Molecular Properties
| Compound Name | hydron;octanoate |
| PubChem CID | 135372298 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | hydron;octanoate |
| SMILES | CCCCCCCC(=O)[O-].[H+] |
| InChI | InChI=1S/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10) |
| InChIKey | WWZKQHOCKIZLMA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hydron;octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;octanoate?
The IUPAC name of hydron;octanoate (CID 135372298) is hydron;octanoate.
What is the SMILES notation for hydron;octanoate?
The canonical SMILES for hydron;octanoate is CCCCCCCC(=O)[O-].[H+].
What is the InChIKey of hydron;octanoate?
The InChIKey is WWZKQHOCKIZLMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10).
What are the key properties of hydron;octanoate?
hydron;octanoate has a molecular weight of 144.21 g/mol, XLogP of 1.21, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;octanoate is sourced from PubChem (CID 135372298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).