C29H36N6OS — CID 135372874
N-[2-(dimethylamino)ethyl]-6-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 135372874) has the molecular formula C29H36N6OS and a molecular weight of 516.72 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-6-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-6-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 135372874 |
| Molecular Formula | C29H36N6OS |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-6-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | CN(C)CCNC(=O)c1cc2ccc(-c3cc(NCCCN4CCCCC4)c4cnccc4n3)cc2s1 |
| InChI | InChI=1S/C29H36N6OS/c1-34(2)16-12-32-29(36)28-18-22-8-7-21(17-27(22)37-28)25-19-26(23-20-30-11-9-24(23)33-25)31-10-6-15-35-13-4-3-5-14-35/h7-9,11,17-20H,3-6,10,12-16H2,1-2H3,(H,31,33)(H,32,36) |
| InChIKey | NFDQGNXZXARULV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|