About (E)-3-[5-(4-chloro-1,6-naphthyridin-2-yl)furan-2-yl]-N,N-diethylprop-2-enamide
(E)-3-[5-(4-chloro-1,6-naphthyridin-2-yl)furan-2-yl]-N,N-diethylprop-2-enamide (PubChem CID 135372919) has the molecular formula C19H18ClN3O2
and a molecular weight of 355.83 g/mol. Its IUPAC name is (E)-3-[5-(4-chloro-1,6-naphthyridin-2-yl)furan-2-yl]-N,N-diethylprop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-[5-(4-chloro-1,6-naphthyridin-2-yl)furan-2-yl]-N,N-diethylprop-2-enamide |
| PubChem CID | 135372919 |
| Molecular Formula | C19H18ClN3O2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (E)-3-[5-(4-chloro-1,6-naphthyridin-2-yl)furan-2-yl]-N,N-diethylprop-2-enamide |
| SMILES | CCN(CC)C(=O)/C=C/c1ccc(-c2cc(Cl)c3cnccc3n2)o1 |
| InChI | InChI=1S/C19H18ClN3O2/c1-3-23(4-2)19(24)8-6-13-5-7-18(25-13)17-11-15(20)14-12-21-10-9-16(14)22-17/h5-12H,3-4H2,1-2H3/b8-6+ |
| InChIKey | UQELDEJABXYNJJ-SOFGYWHQSA-N |
| XLogP | 4.42 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[5-(4-chloro-1,6-naphthyridin-2-yl)furan-2-yl]-N,N-diethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[5-(4-chloro-1,6-naphthyridin-2-yl)furan-2-yl]-N,N-diethylprop-2-enamide?
The IUPAC name of (E)-3-[5-(4-chloro-1,6-naphthyridin-2-yl)furan-2-yl]-N,N-diethylprop-2-enamide (CID 135372919) is (E)-3-[5-(4-chloro-1,6-naphthyridin-2-yl)furan-2-yl]-N,N-diethylprop-2-enamide.
What is the SMILES notation for (E)-3-[5-(4-chloro-1,6-naphthyridin-2-yl)furan-2-yl]-N,N-diethylprop-2-enamide?
The canonical SMILES for (E)-3-[5-(4-chloro-1,6-naphthyridin-2-yl)furan-2-yl]-N,N-diethylprop-2-enamide is CCN(CC)C(=O)/C=C/c1ccc(-c2cc(Cl)c3cnccc3n2)o1.
What is the InChIKey of (E)-3-[5-(4-chloro-1,6-naphthyridin-2-yl)furan-2-yl]-N,N-diethylprop-2-enamide?
The InChIKey is UQELDEJABXYNJJ-SOFGYWHQSA-N. The full InChI is InChI=1S/C19H18ClN3O2/c1-3-23(4-2)19(24)8-6-13-5-7-18(25-13)17-11-15(20)14-12-21-10-9-16(14)22-17/h5-12H,3-4H2,1-2H3/b8-6+.
What are the key properties of (E)-3-[5-(4-chloro-1,6-naphthyridin-2-yl)furan-2-yl]-N,N-diethylprop-2-enamide?
(E)-3-[5-(4-chloro-1,6-naphthyridin-2-yl)furan-2-yl]-N,N-diethylprop-2-enamide has a molecular weight of 355.83 g/mol, XLogP of 4.42, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[5-(4-chloro-1,6-naphthyridin-2-yl)furan-2-yl]-N,N-diethylprop-2-enamide is sourced from PubChem (CID 135372919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).