C29H35N5OS — CID 135372965
N,N-diethyl-6-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 135372965) has the molecular formula C29H35N5OS and a molecular weight of 501.70 g/mol. Its IUPAC name is N,N-diethyl-6-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | N,N-diethyl-6-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 135372965 |
| Molecular Formula | C29H35N5OS |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | N,N-diethyl-6-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc2ccc(-c3cc(NCCCN4CCCCC4)c4cnccc4n3)cc2s1 |
| InChI | InChI=1S/C29H35N5OS/c1-3-34(4-2)29(35)28-18-22-10-9-21(17-27(22)36-28)25-19-26(23-20-30-13-11-24(23)32-25)31-12-8-16-33-14-6-5-7-15-33/h9-11,13,17-20H,3-8,12,14-16H2,1-2H3,(H,31,32) |
| InChIKey | YJZVANOCLDOJJS-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|