C32H40N6OS — CID 135373064
N-(1-ethylpiperidin-4-yl)-6-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 135373064) has the molecular formula C32H40N6OS and a molecular weight of 556.78 g/mol. Its IUPAC name is N-(1-ethylpiperidin-4-yl)-6-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-(1-ethylpiperidin-4-yl)-6-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 135373064 |
| Molecular Formula | C32H40N6OS |
| Molecular Weight | 556.78 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | N-(1-ethylpiperidin-4-yl)-6-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | CCN1CCC(NC(=O)c2cc3ccc(-c4cc(NCCCN5CCCCC5)c5cnccc5n4)cc3s2)CC1 |
| InChI | InChI=1S/C32H40N6OS/c1-2-37-17-10-25(11-18-37)35-32(39)31-20-24-8-7-23(19-30(24)40-31)28-21-29(26-22-33-13-9-27(26)36-28)34-12-6-16-38-14-4-3-5-15-38/h7-9,13,19-22,25H,2-6,10-12,14-18H2,1H3,(H,34,36)(H,35,39) |
| InChIKey | FDCROYLZVBTPNJ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.78 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|