About decanoate;hydron
decanoate;hydron (PubChem CID 135373094) has the molecular formula C10H20O2
and a molecular weight of 172.27 g/mol. Its IUPAC name is decanoate;hydron.
Molecular Properties
| Compound Name | decanoate;hydron |
| PubChem CID | 135373094 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | decanoate;hydron |
| SMILES | CCCCCCCCCC(=O)[O-].[H+] |
| InChI | InChI=1S/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12) |
| InChIKey | GHVNFZFCNZKVNT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decanoate;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decanoate;hydron?
The IUPAC name of decanoate;hydron (CID 135373094) is decanoate;hydron.
What is the SMILES notation for decanoate;hydron?
The canonical SMILES for decanoate;hydron is CCCCCCCCCC(=O)[O-].[H+].
What is the InChIKey of decanoate;hydron?
The InChIKey is GHVNFZFCNZKVNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12).
What are the key properties of decanoate;hydron?
decanoate;hydron has a molecular weight of 172.27 g/mol, XLogP of 1.99, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decanoate;hydron is sourced from PubChem (CID 135373094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).