C31H40N6O — CID 135373118
(E)-N-(1-methylpiperidin-4-yl)-3-[4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]phenyl]prop-2-enamide (PubChem CID 135373118) has the molecular formula C31H40N6O and a molecular weight of 512.70 g/mol. Its IUPAC name is (E)-N-(1-methylpiperidin-4-yl)-3-[4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(1-methylpiperidin-4-yl)-3-[4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135373118 |
| Molecular Formula | C31H40N6O |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.33 |
| IUPAC Name | (E)-N-(1-methylpiperidin-4-yl)-3-[4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]phenyl]prop-2-enamide |
| SMILES | CN1CCC(NC(=O)/C=C/c2ccc(-c3cc(NCCCN4CCCCC4)c4cnccc4n3)cc2)CC1 |
| InChI | InChI=1S/C31H40N6O/c1-36-20-13-26(14-21-36)34-31(38)11-8-24-6-9-25(10-7-24)29-22-30(27-23-32-16-12-28(27)35-29)33-15-5-19-37-17-3-2-4-18-37/h6-12,16,22-23,26H,2-5,13-15,17-21H2,1H3,(H,33,35)(H,34,38)/b11-8+ |
| InChIKey | DYGCJQIITPNJCR-DHZHZOJOSA-N |
| XLogP | 4.81 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|