About [2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] heptanoate
[2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] heptanoate (PubChem CID 135373389) has the molecular formula C17H25NO5
and a molecular weight of 323.39 g/mol. Its IUPAC name is [2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] heptanoate.
Molecular Properties
| Compound Name | [2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] heptanoate |
| PubChem CID | 135373389 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | [2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] heptanoate |
| SMILES | CCCCCCC(=O)OCC(=O)NCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C17H25NO5/c1-3-4-5-6-7-17(21)23-12-16(20)18-11-13-8-9-14(19)15(10-13)22-2/h8-10,19H,3-7,11-12H2,1-2H3,(H,18,20) |
| InChIKey | BOSQFZFFFLEMBU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] heptanoate?
The IUPAC name of [2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] heptanoate (CID 135373389) is [2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] heptanoate.
What is the SMILES notation for [2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] heptanoate?
The canonical SMILES for [2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] heptanoate is CCCCCCC(=O)OCC(=O)NCc1ccc(O)c(OC)c1.
What is the InChIKey of [2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] heptanoate?
The InChIKey is BOSQFZFFFLEMBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO5/c1-3-4-5-6-7-17(21)23-12-16(20)18-11-13-8-9-14(19)15(10-13)22-2/h8-10,19H,3-7,11-12H2,1-2H3,(H,18,20).
What are the key properties of [2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] heptanoate?
[2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] heptanoate has a molecular weight of 323.39 g/mol, XLogP of 2.53, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] heptanoate is sourced from PubChem (CID 135373389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).