C20H27NO5 — CID 135373392
[2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] (2E)-3,7-dimethylocta-2,6-dienoate (PubChem CID 135373392) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is [2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] (2E)-3,7-dimethylocta-2,6-dienoate.
| Compound Name | [2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] (2E)-3,7-dimethylocta-2,6-dienoate |
|---|---|
| PubChem CID | 135373392 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | [2-[(4-hydroxy-3-methoxyphenyl)methylamino]-2-oxoethyl] (2E)-3,7-dimethylocta-2,6-dienoate |
| SMILES | COc1cc(CNC(=O)COC(=O)/C=C(\C)CCC=C(C)C)ccc1O |
| InChI | InChI=1S/C20H27NO5/c1-14(2)6-5-7-15(3)10-20(24)26-13-19(23)21-12-16-8-9-17(22)18(11-16)25-4/h6,8-11,22H,5,7,12-13H2,1-4H3,(H,21,23)/b15-10+ |
| InChIKey | AASQUMOOVNOZMI-XNTDXEJSSA-N |
| XLogP | 3.25 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|