5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid

C9H15NO3 — CID 135373530

IUPAC5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid
SMILESO=C(O)N1CC2CCC(O)CC2C1
InChIInChI=1S/C9H15NO3/c11-8-2-1-6-4-10(9(12)13)5-7(6)3-8/h6-8,11H,1-5H2,(H,12,13)
InChIKeyALBOIPBGDNAXEF-UHFFFAOYSA-N
MW185.22 g/mol
LogP0.76
Rot. Bonds

About 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid

5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid (PubChem CID 135373530) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid.

Molecular Properties

Compound Name5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid
PubChem CID135373530
Molecular FormulaC9H15NO3
Molecular Weight185.22 g/mol
Exact Mass185.11
IUPAC Name5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid
SMILESO=C(O)N1CC2CCC(O)CC2C1
InChIInChI=1S/C9H15NO3/c11-8-2-1-6-4-10(9(12)13)5-7(6)3-8/h6-8,11H,1-5H2,(H,12,13)
InChIKeyALBOIPBGDNAXEF-UHFFFAOYSA-N
XLogP0.76
TPSA60.77 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.22
LogP ≤ 50.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid?
The IUPAC name of 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid (CID 135373530) is 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid.
What is the SMILES notation for 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid?
The canonical SMILES for 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid is O=C(O)N1CC2CCC(O)CC2C1.
What is the InChIKey of 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid?
The InChIKey is ALBOIPBGDNAXEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c11-8-2-1-6-4-10(9(12)13)5-7(6)3-8/h6-8,11H,1-5H2,(H,12,13).
What are the key properties of 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid?
5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid has a molecular weight of 185.22 g/mol, XLogP of 0.76, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxylic acid is sourced from PubChem (CID 135373530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).