C26H30F3N3O6S — CID 135374079
2-(2,2-dimethyl-1,1,3-trioxo-4H-1λ6,4-benzothiazin-6-yl)-N-[2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-[3-(trifluoromethoxy)phenyl]ethyl]-N-methylacetamide (PubChem CID 135374079) has the molecular formula C26H30F3N3O6S and a molecular weight of 569.60 g/mol. Its IUPAC name is 2-(2,2-dimethyl-1,1,3-trioxo-4H-1λ6,4-benzothiazin-6-yl)-N-[2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-[3-(trifluoromethoxy)phenyl]ethyl]-N-methylacetamide.
| Compound Name | 2-(2,2-dimethyl-1,1,3-trioxo-4H-1λ6,4-benzothiazin-6-yl)-N-[2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-[3-(trifluoromethoxy)phenyl]ethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 135374079 |
| Molecular Formula | C26H30F3N3O6S |
| Molecular Weight | 569.60 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 2-(2,2-dimethyl-1,1,3-trioxo-4H-1λ6,4-benzothiazin-6-yl)-N-[2-[(3S)-3-hydroxypyrrolidin-1-yl]-1-[3-(trifluoromethoxy)phenyl]ethyl]-N-methylacetamide |
| SMILES | CN(C(=O)Cc1ccc2c(c1)NC(=O)C(C)(C)S2(=O)=O)C(CN1CC[C@H](O)C1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C26H30F3N3O6S/c1-25(2)24(35)30-20-11-16(7-8-22(20)39(25,36)37)12-23(34)31(3)21(15-32-10-9-18(33)14-32)17-5-4-6-19(13-17)38-26(27,28)29/h4-8,11,13,18,21,33H,9-10,12,14-15H2,1-3H3,(H,30,35)/t18-,21?/m0/s1 |
| InChIKey | LASLJFPBCBLXBK-YMXDCFFPSA-N |
| XLogP | 2.90 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.60 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |