C18H27F2N3O6 — CID 135374326
ethyl 2-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-methylpyrazol-1-yl]-2,2-difluoroacetate (PubChem CID 135374326) has the molecular formula C18H27F2N3O6 and a molecular weight of 419.43 g/mol. Its IUPAC name is ethyl 2-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-methylpyrazol-1-yl]-2,2-difluoroacetate.
| Compound Name | ethyl 2-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-methylpyrazol-1-yl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 135374326 |
| Molecular Formula | C18H27F2N3O6 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | ethyl 2-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-methylpyrazol-1-yl]-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)n1cc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c(C)n1 |
| InChI | InChI=1S/C18H27F2N3O6/c1-9-27-13(24)18(19,20)22-10-12(11(2)21-22)23(14(25)28-16(3,4)5)15(26)29-17(6,7)8/h10H,9H2,1-8H3 |
| InChIKey | AECXVNBXIVERGU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|