About 4-ethyl-9-[(4-fluorophenyl)methyl]-2,2-dimethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one
4-ethyl-9-[(4-fluorophenyl)methyl]-2,2-dimethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (PubChem CID 135374675) has the molecular formula C19H27FN2O2
and a molecular weight of 334.44 g/mol. Its IUPAC name is 4-ethyl-9-[(4-fluorophenyl)methyl]-2,2-dimethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
Molecular Properties
| Compound Name | 4-ethyl-9-[(4-fluorophenyl)methyl]-2,2-dimethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| PubChem CID | 135374675 |
| Molecular Formula | C19H27FN2O2 |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 4-ethyl-9-[(4-fluorophenyl)methyl]-2,2-dimethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| SMILES | CCN1CC2(CCN(Cc3ccc(F)cc3)CC2)OC(C)(C)C1=O |
| InChI | InChI=1S/C19H27FN2O2/c1-4-22-14-19(24-18(2,3)17(22)23)9-11-21(12-10-19)13-15-5-7-16(20)8-6-15/h5-8H,4,9-14H2,1-3H3 |
| InChIKey | FSNDEISHJFQHTL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-9-[(4-fluorophenyl)methyl]-2,2-dimethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-9-[(4-fluorophenyl)methyl]-2,2-dimethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one?
The IUPAC name of 4-ethyl-9-[(4-fluorophenyl)methyl]-2,2-dimethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (CID 135374675) is 4-ethyl-9-[(4-fluorophenyl)methyl]-2,2-dimethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
What is the SMILES notation for 4-ethyl-9-[(4-fluorophenyl)methyl]-2,2-dimethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one?
The canonical SMILES for 4-ethyl-9-[(4-fluorophenyl)methyl]-2,2-dimethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one is CCN1CC2(CCN(Cc3ccc(F)cc3)CC2)OC(C)(C)C1=O.
What is the InChIKey of 4-ethyl-9-[(4-fluorophenyl)methyl]-2,2-dimethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one?
The InChIKey is FSNDEISHJFQHTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27FN2O2/c1-4-22-14-19(24-18(2,3)17(22)23)9-11-21(12-10-19)13-15-5-7-16(20)8-6-15/h5-8H,4,9-14H2,1-3H3.
What are the key properties of 4-ethyl-9-[(4-fluorophenyl)methyl]-2,2-dimethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one?
4-ethyl-9-[(4-fluorophenyl)methyl]-2,2-dimethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one has a molecular weight of 334.44 g/mol, XLogP of 2.82, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-9-[(4-fluorophenyl)methyl]-2,2-dimethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one is sourced from PubChem (CID 135374675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).