About US10927128, Example 84
US10927128, Example 84 (PubChem CID 135374773) has the molecular formula C17H23FN2O2
and a molecular weight of 306.37 g/mol. Its IUPAC name is (2R)-9-[(4-fluorophenyl)methyl]-2,4-dimethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
Molecular Properties
| Compound Name | US10927128, Example 84 |
| PubChem CID | 135374773 |
| Molecular Formula | C17H23FN2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (2R)-9-[(4-fluorophenyl)methyl]-2,4-dimethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| SMILES | C[C@@H]1C(=O)N(CC2(O1)CCN(CC2)CC3=CC=C(C=C3)F)C |
| InChI | InChI=1S/C17H23FN2O2/c1-13-16(21)19(2)12-17(22-13)7-9-20(10-8-17)11-14-3-5-15(18)6-4-14/h3-6,13H,7-12H2,1-2H3/t13-/m1/s1 |
| InChIKey | OEMSROHIBZGYHN-CYBMUJFWSA-N |
| XLogP | 1.80 |
| TPSA | 32.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | 401 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze US10927128, Example 84 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US10927128, Example 84?
The IUPAC name of US10927128, Example 84 (CID 135374773) is (2R)-9-[(4-fluorophenyl)methyl]-2,4-dimethyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
What is the SMILES notation for US10927128, Example 84?
The canonical SMILES for US10927128, Example 84 is C[C@@H]1C(=O)N(CC2(O1)CCN(CC2)CC3=CC=C(C=C3)F)C.
What is the InChIKey of US10927128, Example 84?
The InChIKey is OEMSROHIBZGYHN-CYBMUJFWSA-N. The full InChI is InChI=1S/C17H23FN2O2/c1-13-16(21)19(2)12-17(22-13)7-9-20(10-8-17)11-14-3-5-15(18)6-4-14/h3-6,13H,7-12H2,1-2H3/t13-/m1/s1.
What are the key properties of US10927128, Example 84?
US10927128, Example 84 has a molecular weight of 306.37 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for US10927128, Example 84 is sourced from PubChem (CID 135374773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).