C22H23F6N5O2 — CID 135375447
N-[1-[2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]-N-methylacetamide (PubChem CID 135375447) has the molecular formula C22H23F6N5O2 and a molecular weight of 503.45 g/mol. Its IUPAC name is N-[1-[2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]-N-methylacetamide.
| Compound Name | N-[1-[2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 135375447 |
| Molecular Formula | C22H23F6N5O2 |
| Molecular Weight | 503.45 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | N-[1-[2-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]-N-methylacetamide |
| SMILES | CC(=O)N(C)c1cnn(C(=O)N2CC3CN(Cc4cc(C(F)(F)F)cc(C(F)(F)F)c4)CC3C2)c1 |
| InChI | InChI=1S/C22H23F6N5O2/c1-13(34)30(2)19-6-29-33(12-19)20(35)32-10-15-8-31(9-16(15)11-32)7-14-3-17(21(23,24)25)5-18(4-14)22(26,27)28/h3-6,12,15-16H,7-11H2,1-2H3 |
| InChIKey | URHAOHXLVUIYEC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |