C23H29F3N6O3S — CID 135375595
N-[1-[2-[[4-pyrrolidin-1-yl-2-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]methanesulfonamide (PubChem CID 135375595) has the molecular formula C23H29F3N6O3S and a molecular weight of 526.59 g/mol. Its IUPAC name is N-[1-[2-[[4-pyrrolidin-1-yl-2-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]methanesulfonamide.
| Compound Name | N-[1-[2-[[4-pyrrolidin-1-yl-2-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 135375595 |
| Molecular Formula | C23H29F3N6O3S |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | N-[1-[2-[[4-pyrrolidin-1-yl-2-(trifluoromethyl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cnn(C(=O)N2CC3CN(Cc4ccc(N5CCCC5)cc4C(F)(F)F)CC3C2)c1 |
| InChI | InChI=1S/C23H29F3N6O3S/c1-36(34,35)28-19-9-27-32(15-19)22(33)31-13-17-11-29(12-18(17)14-31)10-16-4-5-20(30-6-2-3-7-30)8-21(16)23(24,25)26/h4-5,8-9,15,17-18,28H,2-3,6-7,10-14H2,1H3 |
| InChIKey | UJLYNNCQFRVDIH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|