C20H23ClFN5O2 — CID 135375641
N-[1-[2-[(3-chloro-4-fluorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]-N-methylacetamide (PubChem CID 135375641) has the molecular formula C20H23ClFN5O2 and a molecular weight of 419.89 g/mol. Its IUPAC name is N-[1-[2-[(3-chloro-4-fluorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]-N-methylacetamide.
| Compound Name | N-[1-[2-[(3-chloro-4-fluorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 135375641 |
| Molecular Formula | C20H23ClFN5O2 |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-[1-[2-[(3-chloro-4-fluorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-4-yl]-N-methylacetamide |
| SMILES | CC(=O)N(C)c1cnn(C(=O)N2CC3CN(Cc4ccc(F)c(Cl)c4)CC3C2)c1 |
| InChI | InChI=1S/C20H23ClFN5O2/c1-13(28)24(2)17-6-23-27(12-17)20(29)26-10-15-8-25(9-16(15)11-26)7-14-3-4-19(22)18(21)5-14/h3-6,12,15-16H,7-11H2,1-2H3 |
| InChIKey | KWSMLCBRTAIGER-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |