C25H24F3N7O — CID 135376981
1-[6-[[3-(2,6-dimethylanilino)-1-methylpyrazolo[3,4-d]pyrimidin-6-yl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone (PubChem CID 135376981) has the molecular formula C25H24F3N7O and a molecular weight of 495.51 g/mol. Its IUPAC name is 1-[6-[[3-(2,6-dimethylanilino)-1-methylpyrazolo[3,4-d]pyrimidin-6-yl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[6-[[3-(2,6-dimethylanilino)-1-methylpyrazolo[3,4-d]pyrimidin-6-yl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 135376981 |
| Molecular Formula | C25H24F3N7O |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 1-[6-[[3-(2,6-dimethylanilino)-1-methylpyrazolo[3,4-d]pyrimidin-6-yl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone |
| SMILES | Cc1cccc(C)c1Nc1nn(C)c2nc(Nc3ccc4c(c3)CCN(C(=O)C(F)(F)F)C4)ncc12 |
| InChI | InChI=1S/C25H24F3N7O/c1-14-5-4-6-15(2)20(14)31-21-19-12-29-24(32-22(19)34(3)33-21)30-18-8-7-17-13-35(10-9-16(17)11-18)23(36)25(26,27)28/h4-8,11-12H,9-10,13H2,1-3H3,(H,31,33)(H,29,30,32) |
| InChIKey | XUIRRIUETBVSCC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |