About 6-chloro-N-(2,6-dimethylphenyl)-1-methylpyrazolo[3,4-d]pyrimidin-3-amine
6-chloro-N-(2,6-dimethylphenyl)-1-methylpyrazolo[3,4-d]pyrimidin-3-amine (PubChem CID 135376996) has the molecular formula C14H14ClN5
and a molecular weight of 287.75 g/mol. Its IUPAC name is 6-chloro-N-(2,6-dimethylphenyl)-1-methylpyrazolo[3,4-d]pyrimidin-3-amine.
Molecular Properties
| Compound Name | 6-chloro-N-(2,6-dimethylphenyl)-1-methylpyrazolo[3,4-d]pyrimidin-3-amine |
| PubChem CID | 135376996 |
| Molecular Formula | C14H14ClN5 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 6-chloro-N-(2,6-dimethylphenyl)-1-methylpyrazolo[3,4-d]pyrimidin-3-amine |
| SMILES | Cc1cccc(C)c1Nc1nn(C)c2nc(Cl)ncc12 |
| InChI | InChI=1S/C14H14ClN5/c1-8-5-4-6-9(2)11(8)17-12-10-7-16-14(15)18-13(10)20(3)19-12/h4-7H,1-3H3,(H,17,19) |
| InChIKey | VMUFUDJPUMSUMP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-N-(2,6-dimethylphenyl)-1-methylpyrazolo[3,4-d]pyrimidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(2,6-dimethylphenyl)-1-methylpyrazolo[3,4-d]pyrimidin-3-amine?
The IUPAC name of 6-chloro-N-(2,6-dimethylphenyl)-1-methylpyrazolo[3,4-d]pyrimidin-3-amine (CID 135376996) is 6-chloro-N-(2,6-dimethylphenyl)-1-methylpyrazolo[3,4-d]pyrimidin-3-amine.
What is the SMILES notation for 6-chloro-N-(2,6-dimethylphenyl)-1-methylpyrazolo[3,4-d]pyrimidin-3-amine?
The canonical SMILES for 6-chloro-N-(2,6-dimethylphenyl)-1-methylpyrazolo[3,4-d]pyrimidin-3-amine is Cc1cccc(C)c1Nc1nn(C)c2nc(Cl)ncc12.
What is the InChIKey of 6-chloro-N-(2,6-dimethylphenyl)-1-methylpyrazolo[3,4-d]pyrimidin-3-amine?
The InChIKey is VMUFUDJPUMSUMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClN5/c1-8-5-4-6-9(2)11(8)17-12-10-7-16-14(15)18-13(10)20(3)19-12/h4-7H,1-3H3,(H,17,19).
What are the key properties of 6-chloro-N-(2,6-dimethylphenyl)-1-methylpyrazolo[3,4-d]pyrimidin-3-amine?
6-chloro-N-(2,6-dimethylphenyl)-1-methylpyrazolo[3,4-d]pyrimidin-3-amine has a molecular weight of 287.75 g/mol, XLogP of 3.38, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(2,6-dimethylphenyl)-1-methylpyrazolo[3,4-d]pyrimidin-3-amine is sourced from PubChem (CID 135376996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).