About 6-chloro-N-[2,6-di(propan-2-yl)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-3-amine
6-chloro-N-[2,6-di(propan-2-yl)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-3-amine (PubChem CID 135377067) has the molecular formula C18H22ClN5
and a molecular weight of 343.86 g/mol. Its IUPAC name is 6-chloro-N-[2,6-di(propan-2-yl)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-3-amine.
Molecular Properties
| Compound Name | 6-chloro-N-[2,6-di(propan-2-yl)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-3-amine |
| PubChem CID | 135377067 |
| Molecular Formula | C18H22ClN5 |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 6-chloro-N-[2,6-di(propan-2-yl)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-3-amine |
| SMILES | CC(C)c1cccc(C(C)C)c1Nc1nn(C)c2nc(Cl)ncc12 |
| InChI | InChI=1S/C18H22ClN5/c1-10(2)12-7-6-8-13(11(3)4)15(12)21-16-14-9-20-18(19)22-17(14)24(5)23-16/h6-11H,1-5H3,(H,21,23) |
| InChIKey | MGZAKSHPRVJLMK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-N-[2,6-di(propan-2-yl)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-[2,6-di(propan-2-yl)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-3-amine?
The IUPAC name of 6-chloro-N-[2,6-di(propan-2-yl)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-3-amine (CID 135377067) is 6-chloro-N-[2,6-di(propan-2-yl)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-3-amine.
What is the SMILES notation for 6-chloro-N-[2,6-di(propan-2-yl)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-3-amine?
The canonical SMILES for 6-chloro-N-[2,6-di(propan-2-yl)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-3-amine is CC(C)c1cccc(C(C)C)c1Nc1nn(C)c2nc(Cl)ncc12.
What is the InChIKey of 6-chloro-N-[2,6-di(propan-2-yl)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-3-amine?
The InChIKey is MGZAKSHPRVJLMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22ClN5/c1-10(2)12-7-6-8-13(11(3)4)15(12)21-16-14-9-20-18(19)22-17(14)24(5)23-16/h6-11H,1-5H3,(H,21,23).
What are the key properties of 6-chloro-N-[2,6-di(propan-2-yl)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-3-amine?
6-chloro-N-[2,6-di(propan-2-yl)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-3-amine has a molecular weight of 343.86 g/mol, XLogP of 5.01, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-[2,6-di(propan-2-yl)phenyl]-1-methylpyrazolo[3,4-d]pyrimidin-3-amine is sourced from PubChem (CID 135377067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).