C30H28F3N9O — CID 135377088
1-[4-methyl-3-[[1-methyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-yl]amino]phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 135377088) has the molecular formula C30H28F3N9O and a molecular weight of 587.61 g/mol. Its IUPAC name is 1-[4-methyl-3-[[1-methyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-yl]amino]phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-methyl-3-[[1-methyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-yl]amino]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 135377088 |
| Molecular Formula | C30H28F3N9O |
| Molecular Weight | 587.61 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | 1-[4-methyl-3-[[1-methyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-yl]amino]phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2cccc(C(F)(F)F)c2)cc1Nc1nn(C)c2nc(Nc3ccc4c(c3)CNCC4)ncc12 |
| InChI | InChI=1S/C30H28F3N9O/c1-17-6-8-23(38-29(43)37-21-5-3-4-20(13-21)30(31,32)33)14-25(17)39-26-24-16-35-28(40-27(24)42(2)41-26)36-22-9-7-18-10-11-34-15-19(18)12-22/h3-9,12-14,16,34H,10-11,15H2,1-2H3,(H,39,41)(H,35,36,40)(H2,37,38,43) |
| InChIKey | GIAMOPWGDZUOFJ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 120.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.61 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |