C25H26F26N2O3 — CID 135377136
3-[bis(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxynonyl)amino]-N,N-diethylpropanamide (PubChem CID 135377136) has the molecular formula C25H26F26N2O3 and a molecular weight of 896.44 g/mol. Its IUPAC name is 3-[bis(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxynonyl)amino]-N,N-diethylpropanamide.
| Compound Name | 3-[bis(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxynonyl)amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 135377136 |
| Molecular Formula | C25H26F26N2O3 |
| Molecular Weight | 896.44 g/mol |
| Exact Mass | 896.15 |
| IUPAC Name | 3-[bis(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxynonyl)amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCN(CC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H26F26N2O3/c1-3-53(4-2)13(56)5-6-52(9-11(54)7-14(26,27)16(30,31)18(34,35)20(38,39)22(42,43)24(46,47)48)10-12(55)8-15(28,29)17(32,33)19(36,37)21(40,41)23(44,45)25(49,50)51/h11-12,54-55H,3-10H2,1-2H3 |
| InChIKey | USHRANYCJYYOHF-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.44 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|