C18H21F3O5S — CID 135379279
(1S,4aS,10aR)-1,4a-dimethyl-6-(trifluoromethylsulfonyloxy)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (PubChem CID 135379279) has the molecular formula C18H21F3O5S and a molecular weight of 406.42 g/mol. Its IUPAC name is (1S,4aS,10aR)-1,4a-dimethyl-6-(trifluoromethylsulfonyloxy)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1S,4aS,10aR)-1,4a-dimethyl-6-(trifluoromethylsulfonyloxy)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 135379279 |
| Molecular Formula | C18H21F3O5S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | (1S,4aS,10aR)-1,4a-dimethyl-6-(trifluoromethylsulfonyloxy)-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| SMILES | C[C@]1(C(=O)O)CCC[C@]2(C)c3cc(OS(=O)(=O)C(F)(F)F)ccc3CC[C@@H]12 |
| InChI | InChI=1S/C18H21F3O5S/c1-16-8-3-9-17(2,15(22)23)14(16)7-5-11-4-6-12(10-13(11)16)26-27(24,25)18(19,20)21/h4,6,10,14H,3,5,7-9H2,1-2H3,(H,22,23)/t14-,16-,17+/m1/s1 |
| InChIKey | NNTAIENHDNJDKG-OIISXLGYSA-N |
| XLogP | 4.01 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|