C14H19ClF2N2O2 — CID 135379397
2-[(3S,4R)-3-amino-4-(3,4-difluorophenyl)pyrrolidin-1-yl]-1-chloro-3-methoxypropan-1-ol (PubChem CID 135379397) has the molecular formula C14H19ClF2N2O2 and a molecular weight of 320.77 g/mol. Its IUPAC name is 2-[(3S,4R)-3-amino-4-(3,4-difluorophenyl)pyrrolidin-1-yl]-1-chloro-3-methoxypropan-1-ol.
| Compound Name | 2-[(3S,4R)-3-amino-4-(3,4-difluorophenyl)pyrrolidin-1-yl]-1-chloro-3-methoxypropan-1-ol |
|---|---|
| PubChem CID | 135379397 |
| Molecular Formula | C14H19ClF2N2O2 |
| Molecular Weight | 320.77 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-[(3S,4R)-3-amino-4-(3,4-difluorophenyl)pyrrolidin-1-yl]-1-chloro-3-methoxypropan-1-ol |
| SMILES | COCC(C(O)Cl)N1C[C@@H](N)[C@H](c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C14H19ClF2N2O2/c1-21-7-13(14(15)20)19-5-9(12(18)6-19)8-2-3-10(16)11(17)4-8/h2-4,9,12-14,20H,5-7,18H2,1H3/t9-,12+,13?,14?/m0/s1 |
| InChIKey | KTRRYKXEKVHGAV-VFEZIHALSA-N |
| XLogP | 1.26 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.77 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|