C33H35F4N7O6S — CID 135379457
N-[6-[[amino-[(1,1,4,6,7-pentamethyl-3H-2-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-oxo-1-(2,3,5,6-tetrafluorophenoxy)hexan-3-yl]-3-azidobenzamide (PubChem CID 135379457) has the molecular formula C33H35F4N7O6S and a molecular weight of 733.75 g/mol. Its IUPAC name is N-[6-[[amino-[(1,1,4,6,7-pentamethyl-3H-2-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-oxo-1-(2,3,5,6-tetrafluorophenoxy)hexan-3-yl]-3-azidobenzamide.
| Compound Name | N-[6-[[amino-[(1,1,4,6,7-pentamethyl-3H-2-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-oxo-1-(2,3,5,6-tetrafluorophenoxy)hexan-3-yl]-3-azidobenzamide |
|---|---|
| PubChem CID | 135379457 |
| Molecular Formula | C33H35F4N7O6S |
| Molecular Weight | 733.75 g/mol |
| Exact Mass | 733.23 |
| IUPAC Name | N-[6-[[amino-[(1,1,4,6,7-pentamethyl-3H-2-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-oxo-1-(2,3,5,6-tetrafluorophenoxy)hexan-3-yl]-3-azidobenzamide |
| SMILES | Cc1c(C)c(S(=O)(=O)N/C(N)=N/CCCC(NC(=O)c2cccc(N=[N+]=[N-])c2)C(=O)COc2c(F)c(F)cc(F)c2F)c(C)c2c1C(C)(C)OC2 |
| InChI | InChI=1S/C33H35F4N7O6S/c1-16-17(2)30(18(3)21-14-50-33(4,5)26(16)21)51(47,48)43-32(38)40-11-7-10-24(41-31(46)19-8-6-9-20(12-19)42-44-39)25(45)15-49-29-27(36)22(34)13-23(35)28(29)37/h6,8-9,12-13,24H,7,10-11,14-15H2,1-5H3,(H,41,46)(H3,38,40,43) |
| InChIKey | DPFVMQJCDXBQBO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 197.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.75 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|