C20H34O3 — CID 135379679
(1R,3S,4E,6S,9E,13E)-6,10,14-trimethyl-3-propan-2-ylcyclotetradeca-4,9,13-triene-1,3,8-triol (PubChem CID 135379679) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (1R,3S,4E,6S,9E,13E)-6,10,14-trimethyl-3-propan-2-ylcyclotetradeca-4,9,13-triene-1,3,8-triol.
| Compound Name | (1R,3S,4E,6S,9E,13E)-6,10,14-trimethyl-3-propan-2-ylcyclotetradeca-4,9,13-triene-1,3,8-triol |
|---|---|
| PubChem CID | 135379679 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (1R,3S,4E,6S,9E,13E)-6,10,14-trimethyl-3-propan-2-ylcyclotetradeca-4,9,13-triene-1,3,8-triol |
| SMILES | C/C1=C/CC/C(C)=C/C(O)C[C@H](C)/C=C/[C@@](O)(C(C)C)C[C@H]1O |
| InChI | InChI=1S/C20H34O3/c1-14(2)20(23)10-9-16(4)12-18(21)11-15(3)7-6-8-17(5)19(22)13-20/h8-11,14,16,18-19,21-23H,6-7,12-13H2,1-5H3/b10-9+,15-11+,17-8-/t16-,18?,19-,20+/m1/s1 |
| InChIKey | UKUYFOKANRWUKT-IMPTWOSBSA-N |
| XLogP | 3.75 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|