C17H14N2O — CID 135379703
6,7-dimethylimidazo[1,2-f]phenanthridin-11-ol (PubChem CID 135379703) has the molecular formula C17H14N2O and a molecular weight of 262.31 g/mol. Its IUPAC name is 6,7-dimethylimidazo[1,2-f]phenanthridin-11-ol.
| Compound Name | 6,7-dimethylimidazo[1,2-f]phenanthridin-11-ol |
|---|---|
| PubChem CID | 135379703 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 6,7-dimethylimidazo[1,2-f]phenanthridin-11-ol |
| SMILES | Cc1cc2c3ccc(O)cc3c3nccn3c2cc1C |
| InChI | InChI=1S/C17H14N2O/c1-10-7-14-13-4-3-12(20)9-15(13)17-18-5-6-19(17)16(14)8-11(10)2/h3-9,20H,1-2H3 |
| InChIKey | LNQMXFLFFJPJFN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|