C16H21NO5 — CID 135379829
1,4-dimethoxy-N-(2-methyl-1-phenylpropyl)-1,4-dioxobutan-2-imine oxide (PubChem CID 135379829) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is 1,4-dimethoxy-N-(2-methyl-1-phenylpropyl)-1,4-dioxobutan-2-imine oxide.
| Compound Name | 1,4-dimethoxy-N-(2-methyl-1-phenylpropyl)-1,4-dioxobutan-2-imine oxide |
|---|---|
| PubChem CID | 135379829 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 1,4-dimethoxy-N-(2-methyl-1-phenylpropyl)-1,4-dioxobutan-2-imine oxide |
| SMILES | COC(=O)C/C(C(=O)OC)=[N+](/[O-])C(c1ccccc1)C(C)C |
| InChI | InChI=1S/C16H21NO5/c1-11(2)15(12-8-6-5-7-9-12)17(20)13(16(19)22-4)10-14(18)21-3/h5-9,11,15H,10H2,1-4H3/b17-13- |
| InChIKey | AHRULRDKJYVXRD-LGMDPLHJSA-N |
| XLogP | 2.07 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|