About 4-[6-[2-(5,7-difluoroquinolin-6-yl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzoic acid
4-[6-[2-(5,7-difluoroquinolin-6-yl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzoic acid (PubChem CID 135380957) has the molecular formula C24H20F2N4O3
and a molecular weight of 450.45 g/mol. Its IUPAC name is 4-[6-[2-(5,7-difluoroquinolin-6-yl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzoic acid.
Molecular Properties
| Compound Name | 4-[6-[2-(5,7-difluoroquinolin-6-yl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzoic acid |
| PubChem CID | 135380957 |
| Molecular Formula | C24H20F2N4O3 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 4-[6-[2-(5,7-difluoroquinolin-6-yl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzoic acid |
| SMILES | CCOc1cc(-c2cc(NCCc3c(F)cc4ncccc4c3F)ncn2)ccc1C(=O)O |
| InChI | InChI=1S/C24H20F2N4O3/c1-2-33-21-10-14(5-6-17(21)24(31)32)19-12-22(30-13-29-19)28-9-7-15-18(25)11-20-16(23(15)26)4-3-8-27-20/h3-6,8,10-13H,2,7,9H2,1H3,(H,31,32)(H,28,29,30) |
| InChIKey | OLQURYYKDDCFFF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[6-[2-(5,7-difluoroquinolin-6-yl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-[2-(5,7-difluoroquinolin-6-yl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzoic acid?
The IUPAC name of 4-[6-[2-(5,7-difluoroquinolin-6-yl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzoic acid (CID 135380957) is 4-[6-[2-(5,7-difluoroquinolin-6-yl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzoic acid.
What is the SMILES notation for 4-[6-[2-(5,7-difluoroquinolin-6-yl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzoic acid?
The canonical SMILES for 4-[6-[2-(5,7-difluoroquinolin-6-yl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzoic acid is CCOc1cc(-c2cc(NCCc3c(F)cc4ncccc4c3F)ncn2)ccc1C(=O)O.
What is the InChIKey of 4-[6-[2-(5,7-difluoroquinolin-6-yl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzoic acid?
The InChIKey is OLQURYYKDDCFFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20F2N4O3/c1-2-33-21-10-14(5-6-17(21)24(31)32)19-12-22(30-13-29-19)28-9-7-15-18(25)11-20-16(23(15)26)4-3-8-27-20/h3-6,8,10-13H,2,7,9H2,1H3,(H,31,32)(H,28,29,30).
What are the key properties of 4-[6-[2-(5,7-difluoroquinolin-6-yl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzoic acid?
4-[6-[2-(5,7-difluoroquinolin-6-yl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzoic acid has a molecular weight of 450.45 g/mol, XLogP of 4.72, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-[2-(5,7-difluoroquinolin-6-yl)ethylamino]pyrimidin-4-yl]-2-ethoxybenzoic acid is sourced from PubChem (CID 135380957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).