C21H26F3N3O2S — CID 135381153
N'-[2,5-dimethyl-4-[3-[S-methyl-N-(2,2,2-trifluoroethyl)sulfonimidoyl]phenoxy]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 135381153) has the molecular formula C21H26F3N3O2S and a molecular weight of 441.52 g/mol. Its IUPAC name is N'-[2,5-dimethyl-4-[3-[S-methyl-N-(2,2,2-trifluoroethyl)sulfonimidoyl]phenoxy]phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2,5-dimethyl-4-[3-[S-methyl-N-(2,2,2-trifluoroethyl)sulfonimidoyl]phenoxy]phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 135381153 |
| Molecular Formula | C21H26F3N3O2S |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | N'-[2,5-dimethyl-4-[3-[S-methyl-N-(2,2,2-trifluoroethyl)sulfonimidoyl]phenoxy]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Oc2cccc(S(C)(=O)=NCC(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C21H26F3N3O2S/c1-6-27(4)14-25-19-10-16(3)20(11-15(19)2)29-17-8-7-9-18(12-17)30(5,28)26-13-21(22,23)24/h7-12,14H,6,13H2,1-5H3/b25-14+ |
| InChIKey | OEWZCPOSHNCAOZ-AFUMVMLFSA-N |
| XLogP | 5.73 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|