About N-(3,5-dimethylphenyl)-4-fluoro-3,5-dimethylaniline
N-(3,5-dimethylphenyl)-4-fluoro-3,5-dimethylaniline (PubChem CID 135382358) has the molecular formula C16H18FN
and a molecular weight of 243.32 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-4-fluoro-3,5-dimethylaniline.
Molecular Properties
| Compound Name | N-(3,5-dimethylphenyl)-4-fluoro-3,5-dimethylaniline |
| PubChem CID | 135382358 |
| Molecular Formula | C16H18FN |
| Molecular Weight | 243.32 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | N-(3,5-dimethylphenyl)-4-fluoro-3,5-dimethylaniline |
| SMILES | Cc1cc(C)cc(Nc2cc(C)c(F)c(C)c2)c1 |
| InChI | InChI=1S/C16H18FN/c1-10-5-11(2)7-14(6-10)18-15-8-12(3)16(17)13(4)9-15/h5-9,18H,1-4H3 |
| InChIKey | HZZPSUAKHMMYNN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.32 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(3,5-dimethylphenyl)-4-fluoro-3,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dimethylphenyl)-4-fluoro-3,5-dimethylaniline?
The IUPAC name of N-(3,5-dimethylphenyl)-4-fluoro-3,5-dimethylaniline (CID 135382358) is N-(3,5-dimethylphenyl)-4-fluoro-3,5-dimethylaniline.
What is the SMILES notation for N-(3,5-dimethylphenyl)-4-fluoro-3,5-dimethylaniline?
The canonical SMILES for N-(3,5-dimethylphenyl)-4-fluoro-3,5-dimethylaniline is Cc1cc(C)cc(Nc2cc(C)c(F)c(C)c2)c1.
What is the InChIKey of N-(3,5-dimethylphenyl)-4-fluoro-3,5-dimethylaniline?
The InChIKey is HZZPSUAKHMMYNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18FN/c1-10-5-11(2)7-14(6-10)18-15-8-12(3)16(17)13(4)9-15/h5-9,18H,1-4H3.
What are the key properties of N-(3,5-dimethylphenyl)-4-fluoro-3,5-dimethylaniline?
N-(3,5-dimethylphenyl)-4-fluoro-3,5-dimethylaniline has a molecular weight of 243.32 g/mol, XLogP of 4.80, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dimethylphenyl)-4-fluoro-3,5-dimethylaniline is sourced from PubChem (CID 135382358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).