About dipropan-2-yl 2-(N-(4-fluoro-3,5-dimethylphenyl)-4-methoxyanilino)propanedioate
dipropan-2-yl 2-(N-(4-fluoro-3,5-dimethylphenyl)-4-methoxyanilino)propanedioate (PubChem CID 135382362) has the molecular formula C24H30FNO5
and a molecular weight of 431.50 g/mol. Its IUPAC name is dipropan-2-yl 2-(N-(4-fluoro-3,5-dimethylphenyl)-4-methoxyanilino)propanedioate.
Molecular Properties
| Compound Name | dipropan-2-yl 2-(N-(4-fluoro-3,5-dimethylphenyl)-4-methoxyanilino)propanedioate |
| PubChem CID | 135382362 |
| Molecular Formula | C24H30FNO5 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | dipropan-2-yl 2-(N-(4-fluoro-3,5-dimethylphenyl)-4-methoxyanilino)propanedioate |
| SMILES | COc1ccc(N(c2cc(C)c(F)c(C)c2)C(C(=O)OC(C)C)C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C24H30FNO5/c1-14(2)30-23(27)22(24(28)31-15(3)4)26(18-8-10-20(29-7)11-9-18)19-12-16(5)21(25)17(6)13-19/h8-15,22H,1-7H3 |
| InChIKey | ZKOBRICCWYGZKI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dipropan-2-yl 2-(N-(4-fluoro-3,5-dimethylphenyl)-4-methoxyanilino)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropan-2-yl 2-(N-(4-fluoro-3,5-dimethylphenyl)-4-methoxyanilino)propanedioate?
The IUPAC name of dipropan-2-yl 2-(N-(4-fluoro-3,5-dimethylphenyl)-4-methoxyanilino)propanedioate (CID 135382362) is dipropan-2-yl 2-(N-(4-fluoro-3,5-dimethylphenyl)-4-methoxyanilino)propanedioate.
What is the SMILES notation for dipropan-2-yl 2-(N-(4-fluoro-3,5-dimethylphenyl)-4-methoxyanilino)propanedioate?
The canonical SMILES for dipropan-2-yl 2-(N-(4-fluoro-3,5-dimethylphenyl)-4-methoxyanilino)propanedioate is COc1ccc(N(c2cc(C)c(F)c(C)c2)C(C(=O)OC(C)C)C(=O)OC(C)C)cc1.
What is the InChIKey of dipropan-2-yl 2-(N-(4-fluoro-3,5-dimethylphenyl)-4-methoxyanilino)propanedioate?
The InChIKey is ZKOBRICCWYGZKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30FNO5/c1-14(2)30-23(27)22(24(28)31-15(3)4)26(18-8-10-20(29-7)11-9-18)19-12-16(5)21(25)17(6)13-19/h8-15,22H,1-7H3.
What are the key properties of dipropan-2-yl 2-(N-(4-fluoro-3,5-dimethylphenyl)-4-methoxyanilino)propanedioate?
dipropan-2-yl 2-(N-(4-fluoro-3,5-dimethylphenyl)-4-methoxyanilino)propanedioate has a molecular weight of 431.50 g/mol, XLogP of 4.86, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dipropan-2-yl 2-(N-(4-fluoro-3,5-dimethylphenyl)-4-methoxyanilino)propanedioate is sourced from PubChem (CID 135382362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).