About adamantane;3H-dithiole
adamantane;3H-dithiole (PubChem CID 135383281) has the molecular formula C13H20S2
and a molecular weight of 240.44 g/mol. Its IUPAC name is adamantane;3H-dithiole.
Molecular Properties
| Compound Name | adamantane;3H-dithiole |
| PubChem CID | 135383281 |
| Molecular Formula | C13H20S2 |
| Molecular Weight | 240.44 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | adamantane;3H-dithiole |
| SMILES | C1=CSSC1.C1C2CC3CC1CC(C2)C3 |
| InChI | InChI=1S/C10H16.C3H4S2/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-2-4-5-3-1/h7-10H,1-6H2;1-2H,3H2 |
| InChIKey | VHAAOLOTMVAKOD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze adamantane;3H-dithiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;3H-dithiole?
The IUPAC name of adamantane;3H-dithiole (CID 135383281) is adamantane;3H-dithiole.
What is the SMILES notation for adamantane;3H-dithiole?
The canonical SMILES for adamantane;3H-dithiole is C1=CSSC1.C1C2CC3CC1CC(C2)C3.
What is the InChIKey of adamantane;3H-dithiole?
The InChIKey is VHAAOLOTMVAKOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.C3H4S2/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-2-4-5-3-1/h7-10H,1-6H2;1-2H,3H2.
What are the key properties of adamantane;3H-dithiole?
adamantane;3H-dithiole has a molecular weight of 240.44 g/mol, XLogP of 4.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;3H-dithiole is sourced from PubChem (CID 135383281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).