C17H25F3N2O — CID 135384501
2-methyl-1-[piperidin-4-yl-[[3-(trifluoromethyl)phenyl]methyl]amino]propan-2-ol (PubChem CID 135384501) has the molecular formula C17H25F3N2O and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-methyl-1-[piperidin-4-yl-[[3-(trifluoromethyl)phenyl]methyl]amino]propan-2-ol.
| Compound Name | 2-methyl-1-[piperidin-4-yl-[[3-(trifluoromethyl)phenyl]methyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 135384501 |
| Molecular Formula | C17H25F3N2O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 2-methyl-1-[piperidin-4-yl-[[3-(trifluoromethyl)phenyl]methyl]amino]propan-2-ol |
| SMILES | CC(C)(O)CN(Cc1cccc(C(F)(F)F)c1)C1CCNCC1 |
| InChI | InChI=1S/C17H25F3N2O/c1-16(2,23)12-22(15-6-8-21-9-7-15)11-13-4-3-5-14(10-13)17(18,19)20/h3-5,10,15,21,23H,6-9,11-12H2,1-2H3 |
| InChIKey | YJTQFAJFYTYXLJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |