About 3-propyl-1,2-benzothiazole 1,1-dioxide
3-propyl-1,2-benzothiazole 1,1-dioxide (PubChem CID 135384944) has the molecular formula C10H11NO2S
and a molecular weight of 209.27 g/mol. Its IUPAC name is 3-propyl-1,2-benzothiazole 1,1-dioxide.
Molecular Properties
| Compound Name | 3-propyl-1,2-benzothiazole 1,1-dioxide |
| PubChem CID | 135384944 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 3-propyl-1,2-benzothiazole 1,1-dioxide |
| SMILES | CCCC1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C10H11NO2S/c1-2-5-9-8-6-3-4-7-10(8)14(12,13)11-9/h3-4,6-7H,2,5H2,1H3 |
| InChIKey | PDGMIRNIVXVZGW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-propyl-1,2-benzothiazole 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyl-1,2-benzothiazole 1,1-dioxide?
The IUPAC name of 3-propyl-1,2-benzothiazole 1,1-dioxide (CID 135384944) is 3-propyl-1,2-benzothiazole 1,1-dioxide.
What is the SMILES notation for 3-propyl-1,2-benzothiazole 1,1-dioxide?
The canonical SMILES for 3-propyl-1,2-benzothiazole 1,1-dioxide is CCCC1=NS(=O)(=O)c2ccccc21.
What is the InChIKey of 3-propyl-1,2-benzothiazole 1,1-dioxide?
The InChIKey is PDGMIRNIVXVZGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2S/c1-2-5-9-8-6-3-4-7-10(8)14(12,13)11-9/h3-4,6-7H,2,5H2,1H3.
What are the key properties of 3-propyl-1,2-benzothiazole 1,1-dioxide?
3-propyl-1,2-benzothiazole 1,1-dioxide has a molecular weight of 209.27 g/mol, XLogP of 1.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-1,2-benzothiazole 1,1-dioxide is sourced from PubChem (CID 135384944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).