C23H19ClN6O — CID 135385330
2-chloro-4-[[1-methyl-2-oxo-4-(1-pyridin-2-ylethylamino)quinolin-6-yl]amino]pyridine-3-carbonitrile (PubChem CID 135385330) has the molecular formula C23H19ClN6O and a molecular weight of 430.90 g/mol. Its IUPAC name is 2-chloro-4-[[1-methyl-2-oxo-4-(1-pyridin-2-ylethylamino)quinolin-6-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 2-chloro-4-[[1-methyl-2-oxo-4-(1-pyridin-2-ylethylamino)quinolin-6-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135385330 |
| Molecular Formula | C23H19ClN6O |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 2-chloro-4-[[1-methyl-2-oxo-4-(1-pyridin-2-ylethylamino)quinolin-6-yl]amino]pyridine-3-carbonitrile |
| SMILES | CC(Nc1cc(=O)n(C)c2ccc(Nc3ccnc(Cl)c3C#N)cc12)c1ccccn1 |
| InChI | InChI=1S/C23H19ClN6O/c1-14(18-5-3-4-9-26-18)28-20-12-22(31)30(2)21-7-6-15(11-16(20)21)29-19-8-10-27-23(24)17(19)13-25/h3-12,14,28H,1-2H3,(H,27,29) |
| InChIKey | PELMLHFTWVSBET-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|