C17H28N2O10 — CID 135385518
methyl (2R,3S,4S)-3-acetamido-4-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(1,2,3-trihydroxypropyl)-2,3-dihydropyran-6-carboxylate (PubChem CID 135385518) has the molecular formula C17H28N2O10 and a molecular weight of 420.42 g/mol. Its IUPAC name is methyl (2R,3S,4S)-3-acetamido-4-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(1,2,3-trihydroxypropyl)-2,3-dihydropyran-6-carboxylate.
| Compound Name | methyl (2R,3S,4S)-3-acetamido-4-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(1,2,3-trihydroxypropyl)-2,3-dihydropyran-6-carboxylate |
|---|---|
| PubChem CID | 135385518 |
| Molecular Formula | C17H28N2O10 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | methyl (2R,3S,4S)-3-acetamido-4-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(1,2,3-trihydroxypropyl)-2,3-dihydropyran-6-carboxylate |
| SMILES | COC(=O)C1=C[C@@](O)(NC(=O)OC(C)(C)C)[C@@H](NC(C)=O)[C@H](C(O)C(O)CO)O1 |
| InChI | InChI=1S/C17H28N2O10/c1-8(21)18-13-12(11(23)9(22)7-20)28-10(14(24)27-5)6-17(13,26)19-15(25)29-16(2,3)4/h6,9,11-13,20,22-23,26H,7H2,1-5H3,(H,18,21)(H,19,25)/t9?,11?,12-,13-,17-/m0/s1 |
| InChIKey | YEVPQQKFQXNDPE-KYUGCLBKSA-N |
| XLogP | -2.13 |
| TPSA | 183.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|