About 3-bromo-6-(4-sulfamoylphenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid
3-bromo-6-(4-sulfamoylphenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 135385618) has the molecular formula C13H9BrN2O4S2
and a molecular weight of 401.26 g/mol. Its IUPAC name is 3-bromo-6-(4-sulfamoylphenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-bromo-6-(4-sulfamoylphenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid |
| PubChem CID | 135385618 |
| Molecular Formula | C13H9BrN2O4S2 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 399.92 |
| IUPAC Name | 3-bromo-6-(4-sulfamoylphenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid |
| SMILES | NS(=O)(=O)c1ccc(-c2c(C(=O)O)[nH]c3c(Br)csc23)cc1 |
| InChI | InChI=1S/C13H9BrN2O4S2/c14-8-5-21-12-9(11(13(17)18)16-10(8)12)6-1-3-7(4-2-6)22(15,19)20/h1-5,16H,(H,17,18)(H2,15,19,20) |
| InChIKey | PBSJCUDJOWVXBS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-6-(4-sulfamoylphenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-6-(4-sulfamoylphenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The IUPAC name of 3-bromo-6-(4-sulfamoylphenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid (CID 135385618) is 3-bromo-6-(4-sulfamoylphenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid.
What is the SMILES notation for 3-bromo-6-(4-sulfamoylphenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The canonical SMILES for 3-bromo-6-(4-sulfamoylphenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid is NS(=O)(=O)c1ccc(-c2c(C(=O)O)[nH]c3c(Br)csc23)cc1.
What is the InChIKey of 3-bromo-6-(4-sulfamoylphenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The InChIKey is PBSJCUDJOWVXBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrN2O4S2/c14-8-5-21-12-9(11(13(17)18)16-10(8)12)6-1-3-7(4-2-6)22(15,19)20/h1-5,16H,(H,17,18)(H2,15,19,20).
What are the key properties of 3-bromo-6-(4-sulfamoylphenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
3-bromo-6-(4-sulfamoylphenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid has a molecular weight of 401.26 g/mol, XLogP of 3.00, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-6-(4-sulfamoylphenyl)-4H-thieno[3,2-b]pyrrole-5-carboxylic acid is sourced from PubChem (CID 135385618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).