C25H25ClN6O4 — CID 135386052
methyl 4-[6-[[6-(but-3-ynylcarbamoyl)-2-chloro-3-cyano-4-pyridinyl]amino]-3-methyl-2-oxobenzimidazol-1-yl]-2-methylbutanoate (PubChem CID 135386052) has the molecular formula C25H25ClN6O4 and a molecular weight of 508.97 g/mol. Its IUPAC name is methyl 4-[6-[[6-(but-3-ynylcarbamoyl)-2-chloro-3-cyano-4-pyridinyl]amino]-3-methyl-2-oxobenzimidazol-1-yl]-2-methylbutanoate.
| Compound Name | methyl 4-[6-[[6-(but-3-ynylcarbamoyl)-2-chloro-3-cyano-4-pyridinyl]amino]-3-methyl-2-oxobenzimidazol-1-yl]-2-methylbutanoate |
|---|---|
| PubChem CID | 135386052 |
| Molecular Formula | C25H25ClN6O4 |
| Molecular Weight | 508.97 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | methyl 4-[6-[[6-(but-3-ynylcarbamoyl)-2-chloro-3-cyano-4-pyridinyl]amino]-3-methyl-2-oxobenzimidazol-1-yl]-2-methylbutanoate |
| SMILES | C#CCCNC(=O)c1cc(Nc2ccc3c(c2)n(CCC(C)C(=O)OC)c(=O)n3C)c(C#N)c(Cl)n1 |
| InChI | InChI=1S/C25H25ClN6O4/c1-5-6-10-28-23(33)19-13-18(17(14-27)22(26)30-19)29-16-7-8-20-21(12-16)32(25(35)31(20)3)11-9-15(2)24(34)36-4/h1,7-8,12-13,15H,6,9-11H2,2-4H3,(H,28,33)(H,29,30) |
| InChIKey | XLCSGOHTKYWAFK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 131.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.97 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|