C27H38ClNO4 — CID 135387285
5-chloro-2-hydroxy-4-methoxy-6-methyl-3-[(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-(oxetan-3-ylamino)cyclohexyl]penta-2,4-dienyl]benzaldehyde (PubChem CID 135387285) has the molecular formula C27H38ClNO4 and a molecular weight of 476.06 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-4-methoxy-6-methyl-3-[(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-(oxetan-3-ylamino)cyclohexyl]penta-2,4-dienyl]benzaldehyde.
| Compound Name | 5-chloro-2-hydroxy-4-methoxy-6-methyl-3-[(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-(oxetan-3-ylamino)cyclohexyl]penta-2,4-dienyl]benzaldehyde |
|---|---|
| PubChem CID | 135387285 |
| Molecular Formula | C27H38ClNO4 |
| Molecular Weight | 476.06 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 5-chloro-2-hydroxy-4-methoxy-6-methyl-3-[(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-(oxetan-3-ylamino)cyclohexyl]penta-2,4-dienyl]benzaldehyde |
| SMILES | COc1c(Cl)c(C)c(C=O)c(O)c1C/C=C(C)/C=C/[C@@]1(C)[C@H](C)CCC(NC2COC2)[C@@H]1C |
| InChI | InChI=1S/C27H38ClNO4/c1-16(7-9-21-25(31)22(13-30)18(3)24(28)26(21)32-6)11-12-27(5)17(2)8-10-23(19(27)4)29-20-14-33-15-20/h7,11-13,17,19-20,23,29,31H,8-10,14-15H2,1-6H3/b12-11+,16-7+/t17-,19+,23?,27+/m1/s1 |
| InChIKey | RIAZDSKYIIXDAD-LXNUQJOZSA-N |
| XLogP | 5.65 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.06 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|