About 2-butylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridine
2-butylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridine (PubChem CID 135387346) has the molecular formula C21H19NOS3
and a molecular weight of 397.59 g/mol. Its IUPAC name is 2-butylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridine.
Molecular Properties
| Compound Name | 2-butylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridine |
| PubChem CID | 135387346 |
| Molecular Formula | C21H19NOS3 |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 2-butylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridine |
| SMILES | CCCCS(=O)c1cc2c(-c3ccccc3)cc(-c3cccs3)nc2s1 |
| InChI | InChI=1S/C21H19NOS3/c1-2-3-12-26(23)20-14-17-16(15-8-5-4-6-9-15)13-18(22-21(17)25-20)19-10-7-11-24-19/h4-11,13-14H,2-3,12H2,1H3 |
| InChIKey | BTMWGLQOBMVXLA-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-butylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridine?
The IUPAC name of 2-butylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridine (CID 135387346) is 2-butylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridine.
What is the SMILES notation for 2-butylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridine?
The canonical SMILES for 2-butylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridine is CCCCS(=O)c1cc2c(-c3ccccc3)cc(-c3cccs3)nc2s1.
What is the InChIKey of 2-butylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridine?
The InChIKey is BTMWGLQOBMVXLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19NOS3/c1-2-3-12-26(23)20-14-17-16(15-8-5-4-6-9-15)13-18(22-21(17)25-20)19-10-7-11-24-19/h4-11,13-14H,2-3,12H2,1H3.
What are the key properties of 2-butylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridine?
2-butylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridine has a molecular weight of 397.59 g/mol, XLogP of 6.60, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridine is sourced from PubChem (CID 135387346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).