C24H29F3N6O3 — CID 135387794
N-[1-[4-[[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]pyrazol-3-yl]acetamide (PubChem CID 135387794) has the molecular formula C24H29F3N6O3 and a molecular weight of 506.53 g/mol. Its IUPAC name is N-[1-[4-[[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]pyrazol-3-yl]acetamide.
| Compound Name | N-[1-[4-[[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]pyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 135387794 |
| Molecular Formula | C24H29F3N6O3 |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | N-[1-[4-[[4-(1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl)-2-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]pyrazol-3-yl]acetamide |
| SMILES | CC(=O)Nc1ccn(C(=O)N2CCN(Cc3ccc(N4CC5COCC5C4)cc3C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C24H29F3N6O3/c1-16(34)28-22-4-5-33(29-22)23(35)31-8-6-30(7-9-31)11-17-2-3-20(10-21(17)24(25,26)27)32-12-18-14-36-15-19(18)13-32/h2-5,10,18-19H,6-9,11-15H2,1H3,(H,28,29,34) |
| InChIKey | LZVMCZBIDQPUFK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|