About ethyl 5-[(E)-3-(2,3-dimethylimidazol-4-yl)prop-2-enoyl]pyrimidine-2-carboxylate
ethyl 5-[(E)-3-(2,3-dimethylimidazol-4-yl)prop-2-enoyl]pyrimidine-2-carboxylate (PubChem CID 135388106) has the molecular formula C15H16N4O3
and a molecular weight of 300.32 g/mol. Its IUPAC name is ethyl 5-[(E)-3-(2,3-dimethylimidazol-4-yl)prop-2-enoyl]pyrimidine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[(E)-3-(2,3-dimethylimidazol-4-yl)prop-2-enoyl]pyrimidine-2-carboxylate |
| PubChem CID | 135388106 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | ethyl 5-[(E)-3-(2,3-dimethylimidazol-4-yl)prop-2-enoyl]pyrimidine-2-carboxylate |
| SMILES | CCOC(=O)c1ncc(C(=O)/C=C/c2cnc(C)n2C)cn1 |
| InChI | InChI=1S/C15H16N4O3/c1-4-22-15(21)14-17-7-11(8-18-14)13(20)6-5-12-9-16-10(2)19(12)3/h5-9H,4H2,1-3H3/b6-5+ |
| InChIKey | LVLDUDOVLBNFQZ-AATRIKPKSA-N |
| XLogP | 1.59 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-[(E)-3-(2,3-dimethylimidazol-4-yl)prop-2-enoyl]pyrimidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(E)-3-(2,3-dimethylimidazol-4-yl)prop-2-enoyl]pyrimidine-2-carboxylate?
The IUPAC name of ethyl 5-[(E)-3-(2,3-dimethylimidazol-4-yl)prop-2-enoyl]pyrimidine-2-carboxylate (CID 135388106) is ethyl 5-[(E)-3-(2,3-dimethylimidazol-4-yl)prop-2-enoyl]pyrimidine-2-carboxylate.
What is the SMILES notation for ethyl 5-[(E)-3-(2,3-dimethylimidazol-4-yl)prop-2-enoyl]pyrimidine-2-carboxylate?
The canonical SMILES for ethyl 5-[(E)-3-(2,3-dimethylimidazol-4-yl)prop-2-enoyl]pyrimidine-2-carboxylate is CCOC(=O)c1ncc(C(=O)/C=C/c2cnc(C)n2C)cn1.
What is the InChIKey of ethyl 5-[(E)-3-(2,3-dimethylimidazol-4-yl)prop-2-enoyl]pyrimidine-2-carboxylate?
The InChIKey is LVLDUDOVLBNFQZ-AATRIKPKSA-N. The full InChI is InChI=1S/C15H16N4O3/c1-4-22-15(21)14-17-7-11(8-18-14)13(20)6-5-12-9-16-10(2)19(12)3/h5-9H,4H2,1-3H3/b6-5+.
What are the key properties of ethyl 5-[(E)-3-(2,3-dimethylimidazol-4-yl)prop-2-enoyl]pyrimidine-2-carboxylate?
ethyl 5-[(E)-3-(2,3-dimethylimidazol-4-yl)prop-2-enoyl]pyrimidine-2-carboxylate has a molecular weight of 300.32 g/mol, XLogP of 1.59, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(E)-3-(2,3-dimethylimidazol-4-yl)prop-2-enoyl]pyrimidine-2-carboxylate is sourced from PubChem (CID 135388106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).